2-{[2-(Dimethylamino)ethyl]methylamino}ethanol

Specification:
| Hazard Statements H315-H319-H335 | RIDADR NONH for all modes of transport | Symbol GHS07 What is the molecular formula of the compound? The molecular formula of the compound is C7H18N2O. What is the molecular weight of the compound? The molecular weight of the compound is 146.23 g/mol. What is the IUPAC name of the compound? The IUPAC name of the compound is 2-[2-(dimethylamino)ethyl-methylamino]ethanol. What is the InChI of the compound? The InChI of the compound is InChI=1S/C7H18N2O/c1-8(2)4-5-9(3)6-7-10/h10H,4-7H2,1-3H3. What is the InChIKey of the compound? The InChIKey of the compound is LSYBWANTZYUTGJ-UHFFFAOYSA-N. What is the canonical SMILES of the compound? The canonical SMILES of the compound is CN(C)CCN(C)CCO. What is the CAS number of the compound? The CAS number of the compound is 2212-32-0. What is the XLogP3-AA value of the compound? The XLogP3-AA value of the compound is -0.4. How many hydrogen bond donor counts does the compound have? The compound has 1 hydrogen bond donor count. How many rotatable bond counts does the compound have? The compound has 5 rotatable bond counts.

Headquartered in New Jersey, USA, ChemScence is a global leading manufacturer and supplier of building blocks and fine research chemicals. We now have branches in Sweden and India. Our mission is to pave the way for drug discovery by providing the most innovative chemicals with the highest-level quality for a reasonable price.

Our Catalog Products

We deliver an extensive portfolio of products, including Building Blocks,Catalysts&Ligands,Synthetic Reagents,Material Science and ADC Linkers&Protac,.ChemScene now have over 600000 Building Blocks & Intermediates in our catalog and more than 70000 of them are in stock.

For details, please refer to the ChemScene website:https://www.chemscene.com